| MolName | 2,4-dichloro-N-[(Z)-[5-[2-(naphthalen-2-ylamino)-2-oxoethyl]sulfanylfuran-2-yl]methylideneamino]benzamide |
| MolecularFormula | C24H17N3O3Cl2S |
| Smiles | O=C(CSc1ccc(/C=N\NC(c(ccc(Cl)c2)c2Cl)=O)o1)Nc1cc2ccccc2cc1 |
| InChI | InChI=1S/C24H17Cl2N3O3S/c25-17-6-9-20(21(26)12-17)24(31)29-27-13-19-8-10-23(32-19)33-14-22(30)28-18-7-5-15-3-1-2-4-16(15)11-18/h1-13H,14H2,(H,28,30)(H,29,31) |
| InChIK | VKSYMBKFMIMYGR-UHFFFAOYSA-N |
| TotalMolweight | 498.389 |
| Molweight | 498.389 |
| MonoisotopicMass | 497.036766 |
| CLogP | 6.2544 |
| CLogS | -8.298 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 362.34 |
| Relative PSA | 0.25421 |
| PolarSurfaceArea | 109 |
| Druglikeness | 7.2592 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2,4-dichloro-N-[(Z)-[5-[2-(naphthalen-2-ylamino)-2-oxoethyl]sulfanylfuran-2-yl]methylideneamino]benzamide | 2 - 2,4-dichloro-N-[(Z)-[5-[2-(naphthalen-2-ylamino)-2-oxoethyl]sulfanylfuran-2-yl]methylideneamino]benzamide