| MolName | N-[(Z)-(3-bromophenyl)methylideneamino]-2-[(3-bromophenyl)methylsulfanyl]acetamide |
| MolecularFormula | C16H14N2OBr2S |
| Smiles | O=C(CSCc1cc(Br)ccc1)N/N=C\c1cccc(Br)c1 |
| InChI | InChI=1S/C16H14Br2N2OS/c17-14-5-1-3-12(7-14)9-19-20-16(21)11-22-10-13-4-2-6-15(18)8-13/h1-9H,10-11H2,(H,20,21) |
| InChIK | VKXYHWGDQUZUOD-UHFFFAOYSA-N |
| TotalMolweight | 442.174 |
| Molweight | 442.174 |
| MonoisotopicMass | 439.919355 |
| CLogP | 4.8416 |
| CLogS | -6.175 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 269.26 |
| Relative PSA | 0.19869 |
| PolarSurfaceArea | 66.76 |
| Druglikeness | 2.8785 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-bromophenyl)methylideneamino]-2-[(3-bromophenyl)methylsulfanyl]acetamide | 2 - N-[(Z)-(3-bromophenyl)methylideneamino]-2-[(3-bromophenyl)methylsulfanyl]acetamide