| MolName | 3-[2-[(2Z)-2-benzylidenehydrazinyl]-1,3-thiazol-5-yl]-6-nitrochromen-2-one |
| MolecularFormula | C19H12N4O4S |
| Smiles | [O-][N+](c(cc1)cc(C=C2c3cnc(N/N=C\c4ccccc4)s3)c1OC2=O)=O |
| InChI | InChI=1S/C19H12N4O4S/c24-18-15(9-13-8-14(23(25)26)6-7-16(13)27-18)17-11-20-19(28-17)22-21-10-12-4-2-1-3-5-12/h1-11H,(H,20,22) |
| InChIK | VLCZYRAHRNTKCR-UHFFFAOYSA-N |
| TotalMolweight | 392.394 |
| Molweight | 392.394 |
| MonoisotopicMass | 392.057926 |
| CLogP | 4.5494 |
| CLogS | -5.163 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 286.33 |
| Relative PSA | 0.37635 |
| PolarSurfaceArea | 137.64 |
| Druglikeness | -1.1622 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[2-[(2Z)-2-benzylidenehydrazinyl]-1,3-thiazol-5-yl]-6-nitrochromen-2-one | 2 - 3-[2-[(2Z)-2-benzylidenehydrazinyl]-1,3-thiazol-5-yl]-6-nitrochromen-2-one