| MolName | 4-(benzenesulfonamido)-N-[(Z)-(4-fluorophenyl)methylideneamino]benzamide |
| MolecularFormula | C20H16N3O3FS |
| Smiles | O=C(c(cc1)ccc1NS(c1ccccc1)(=O)=O)N/N=C\c(cc1)ccc1F |
| InChI | InChI=1S/C20H16FN3O3S/c21-17-10-6-15(7-11-17)14-22-23-20(25)16-8-12-18(13-9-16)24-28(26,27)19-4-2-1-3-5-19/h1-14,24H,(H,23,25) |
| InChIK | VLJNPZXUHFLAHE-UHFFFAOYSA-N |
| TotalMolweight | 397.429 |
| Molweight | 397.429 |
| MonoisotopicMass | 397.08964 |
| CLogP | 3.6015 |
| CLogS | -5.368 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 293.14 |
| Relative PSA | 0.25943 |
| PolarSurfaceArea | 96.01 |
| Druglikeness | -2.159 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 7 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(benzenesulfonamido)-N-[(Z)-(4-fluorophenyl)methylideneamino]benzamide | 2 - 4-(benzenesulfonamido)-N-[(Z)-(4-fluorophenyl)methylideneamino]benzamide