| MolName | 2-(2-fluorophenoxy)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide |
| MolecularFormula | C17H15N2O2F |
| Smiles | O=C(COc(cccc1)c1F)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C17H15FN2O2/c18-15-10-4-5-11-16(15)22-13-17(21)20-19-12-6-9-14-7-2-1-3-8-14/h1-12H,13H2,(H,20,21) |
| InChIK | VLOMSICODRPXHZ-UHFFFAOYSA-N |
| TotalMolweight | 298.316 |
| Molweight | 298.316 |
| MonoisotopicMass | 298.111756 |
| CLogP | 2.8956 |
| CLogS | -4.107 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 243.6 |
| Relative PSA | 0.18888 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 2.9176 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-fluorophenoxy)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide | 2 - 2-(2-fluorophenoxy)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide