| MolName | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-(4-bromophenyl)-1,3-thiazol-2-amine |
| MolecularFormula | C17H12N3O2BrS |
| Smiles | Brc(cc1)ccc1-c1csc(N/N=C\c(cc2)cc3c2OCO3)n1 |
| InChI | InChI=1S/C17H12BrN3O2S/c18-13-4-2-12(3-5-13)14-9-24-17(20-14)21-19-8-11-1-6-15-16(7-11)23-10-22-15/h1-9H,10H2,(H,20,21) |
| InChIK | VLPICWHEPQLHMF-UHFFFAOYSA-N |
| TotalMolweight | 402.271 |
| Molweight | 402.271 |
| MonoisotopicMass | 400.983358 |
| CLogP | 7.053 |
| CLogS | -6.205 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 262.59 |
| Relative PSA | 0.28295 |
| PolarSurfaceArea | 83.98 |
| Druglikeness | 1.9273 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-(4-bromophenyl)-1,3-thiazol-2-amine | 2 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-(4-bromophenyl)-1,3-thiazol-2-amine