| MolName | N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-4-[(4-phenyl-1,3-thiazol-2-yl)amino]benzamide |
| MolecularFormula | C27H18N5O4BrS |
| Smiles | [O-][N+](c(cc1)cc(Br)c1-c1ccc(/C=N\NC(c(cc2)ccc2Nc2nc(-c3ccccc3)cs2)=O)o1)=O |
| InChI | InChI=1S/C27H18BrN5O4S/c28-23-14-20(33(35)36)10-12-22(23)25-13-11-21(37-25)15-29-32-26(34)18-6-8-19(9-7-18)30-27-31-24(16-38-27)17-4-2-1-3-5-17/h1-16H,(H,30,31)(H,32,34) |
| InChIK | VLWLSIQPLLAMFF-UHFFFAOYSA-N |
| TotalMolweight | 588.441 |
| Molweight | 588.441 |
| MonoisotopicMass | 587.026286 |
| CLogP | 6.6796 |
| CLogS | -9.564 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 404.42 |
| Relative PSA | 0.30496 |
| PolarSurfaceArea | 153.58 |
| Druglikeness | 0.77734 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; limit! thiazol-2-ylamine; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65789 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-4-[(4-phenyl-1,3-thiazol-2-yl)amino]benzamide | 2 - N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-4-[(4-phenyl-1,3-thiazol-2-yl)amino]benzamide