| MolName | N-[5-[2-[(2Z)-2-[(3,5-dichloro-2-phenylmethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide |
| MolecularFormula | C25H19N5O3Cl2S |
| Smiles | O=C(Cc1nnc(NC(c2ccccc2)=O)s1)N/N=C\c1cc(Cl)cc(Cl)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H19Cl2N5O3S/c26-19-11-18(23(20(27)12-19)35-15-16-7-3-1-4-8-16)14-28-30-21(33)13-22-31-32-25(36-22)29-24(34)17-9-5-2-6-10-17/h1-12,14H,13,15H2,(H,30,33)(H,29,32,34) |
| InChIK | VMFKSXTWIDMXEU-UHFFFAOYSA-N |
| TotalMolweight | 540.43 |
| Molweight | 540.43 |
| MonoisotopicMass | 539.058564 |
| CLogP | 5.7503 |
| CLogS | -7.218 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 397.54 |
| Relative PSA | 0.28377 |
| PolarSurfaceArea | 133.81 |
| Druglikeness | 6.2663 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61111 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[5-[2-[(2Z)-2-[(3,5-dichloro-2-phenylmethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide | 2 - N-[5-[2-[(2Z)-2-[(3,5-dichloro-2-phenylmethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide