| MolName | 4-amino-N'-[(Z)-anthracen-9-ylmethylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| MolecularFormula | C18H14N6O |
| Smiles | N/C(/c1nonc1N)=N/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C18H14N6O/c19-17(16-18(20)24-25-23-16)22-21-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-10H,(H2,19,22)(H2,20,24) |
| InChIK | VMQMQKDQQOJKKH-UHFFFAOYSA-N |
| TotalMolweight | 330.35 |
| Molweight | 330.35 |
| MonoisotopicMass | 330.122909 |
| CLogP | 4.5678 |
| CLogS | -5.977 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 254.2 |
| Relative PSA | 0.35252 |
| PolarSurfaceArea | 115.68 |
| Druglikeness | 2.5525 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.48 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N'-[(Z)-anthracen-9-ylmethylideneamino]-1,2,5-oxadiazole-3-carboximidamide | 2 - 4-amino-N'-[(Z)-anthracen-9-ylmethylideneamino]-1,2,5-oxadiazole-3-carboximidamide