| MolName | 4-N,5-N-bis[(Z)-benzylideneamino]-1-(4-nitrophenyl)triazole-4,5-dicarboxamide |
| MolecularFormula | C24H18N8O4 |
| Smiles | [O-][N+](c(cc1)ccc1-n1nnc(C(N/N=C\c2ccccc2)=O)c1C(N/N=C\c1ccccc1)=O)=O |
| InChI | InChI=1S/C24H18N8O4/c33-23(28-25-15-17-7-3-1-4-8-17)21-22(24(34)29-26-16-18-9-5-2-6-10-18)31(30-27-21)19-11-13-20(14-12-19)32(35)36/h1-16H,(H,28,33)(H,29,34) |
| InChIK | VMQQWFIGPXLBMC-UHFFFAOYSA-N |
| TotalMolweight | 482.459 |
| Molweight | 482.459 |
| MonoisotopicMass | 482.145102 |
| CLogP | 2.7444 |
| CLogS | -6.058 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 370.87 |
| Relative PSA | 0.3539 |
| PolarSurfaceArea | 159.45 |
| Druglikeness | -3.7343 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-N,5-N-bis[(Z)-benzylideneamino]-1-(4-nitrophenyl)triazole-4,5-dicarboxamide | 2 - 4-N,5-N-bis[(Z)-benzylideneamino]-1-(4-nitrophenyl)triazole-4,5-dicarboxamide