| MolName | N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| MolecularFormula | C24H28N8O3 |
| Smiles | [O-][N+](c(cccc1)c1-c1ccc(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)o1)=O |
| InChI | InChI=1S/C24H28N8O3/c33-32(34)20-10-4-3-9-19(20)21-12-11-18(35-21)17-25-29-22-26-23(30-13-5-1-6-14-30)28-24(27-22)31-15-7-2-8-16-31/h3-4,9-12,17H,1-2,5-8,13-16H2,(H,26,27,28,29) |
| InChIK | VMSCUMDCOUIBBY-UHFFFAOYSA-N |
| TotalMolweight | 476.539 |
| Molweight | 476.539 |
| MonoisotopicMass | 476.228437 |
| CLogP | 5.4346 |
| CLogS | -7.239 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 369.84 |
| Relative PSA | 0.29069 |
| PolarSurfaceArea | 128.5 |
| Druglikeness | -0.78917 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.48571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 11 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine | 2 - N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine