| MolName | [(Z)-[6-(4-chlorophenyl)sulfanylimidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]thiourea |
| MolecularFormula | C13H10N5ClS3 |
| Smiles | NC(N/N=C\c(n(ccs1)c1n1)c1Sc(cc1)ccc1Cl)=S |
| InChI | InChI=1S/C13H10ClN5S3/c14-8-1-3-9(4-2-8)22-11-10(7-16-18-12(15)20)19-5-6-21-13(19)17-11/h1-7H,(H3,15,18,20) |
| InChIK | VMYUWLTWELHWPY-UHFFFAOYSA-N |
| TotalMolweight | 367.908 |
| Molweight | 367.908 |
| MonoisotopicMass | 366.978682 |
| CLogP | 3.1837 |
| CLogS | -3.958 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 263.33 |
| Relative PSA | 0.46713 |
| PolarSurfaceArea | 153.34 |
| Druglikeness | 3.9265 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 14 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[6-(4-chlorophenyl)sulfanylimidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]thiourea | 2 - [(Z)-[6-(4-chlorophenyl)sulfanylimidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]thiourea