| MolName | N-benzyl-2-[(Z)-[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| MolecularFormula | C34H29N2O2FS |
| Smiles | O=C(c1c(/N=C\c(c2ccccc2cc2)c2OCc(cccc2)c2F)sc2c1CCCC2)NCc1ccccc1 |
| InChI | InChI=1S/C34H29FN2O2S/c35-29-16-8-5-13-25(29)22-39-30-19-18-24-12-4-6-14-26(24)28(30)21-37-34-32(27-15-7-9-17-31(27)40-34)33(38)36-20-23-10-2-1-3-11-23/h1-6,8,10-14,16,18-19,21H,7,9,15,17,20,22H2,(H,36,38) |
| InChIK | VNRQJUCSLLKXAE-UHFFFAOYSA-N |
| TotalMolweight | 548.68 |
| Molweight | 548.68 |
| MonoisotopicMass | 548.193376 |
| CLogP | 7.7466 |
| CLogS | -8.999 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 422.46 |
| Relative PSA | 0.1571 |
| PolarSurfaceArea | 78.93 |
| Druglikeness | -1.7081 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.475 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 8 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-benzyl-2-[(Z)-[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide | 2 - N-benzyl-2-[(Z)-[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide