| MolName | 5-chloro-N-[(Z)-thiophen-3-ylmethylideneamino]thiophene-2-sulfonamide |
| MolecularFormula | C9H7N2O2ClS3 |
| Smiles | O=S(c(s1)ccc1Cl)(N/N=C\c1cscc1)=O |
| InChI | InChI=1S/C9H7ClN2O2S3/c10-8-1-2-9(16-8)17(13,14)12-11-5-7-3-4-15-6-7/h1-6,12H |
| InChIK | VNSURRYREJJMCN-UHFFFAOYSA-N |
| TotalMolweight | 306.818 |
| Molweight | 306.818 |
| MonoisotopicMass | 305.935815 |
| CLogP | 2.8613 |
| CLogS | -2.486 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 205.12 |
| Relative PSA | 0.44983 |
| PolarSurfaceArea | 123.39 |
| Druglikeness | 2.6806 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 1 |
| Symmetricatoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-chloro-N-[(Z)-thiophen-3-ylmethylideneamino]thiophene-2-sulfonamide | 2 - 5-chloro-N-[(Z)-thiophen-3-ylmethylideneamino]thiophene-2-sulfonamide