| MolName | N-[(Z)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-2-(2-bromo-4-nitrophenoxy)acetamide |
| MolecularFormula | C18H14N3O6Br |
| Smiles | [O-][N+](c(cc1)cc(Br)c1OCC(N/N=C\C=C\c(cc1)cc2c1OCO2)=O)=O |
| InChI | InChI=1S/C18H14BrN3O6/c19-14-9-13(22(24)25)4-6-15(14)26-10-18(23)21-20-7-1-2-12-3-5-16-17(8-12)28-11-27-16/h1-9H,10-11H2,(H,21,23) |
| InChIK | VOAXSUQZEAOJKF-UHFFFAOYSA-N |
| TotalMolweight | 448.228 |
| Molweight | 448.228 |
| MonoisotopicMass | 447.006598 |
| CLogP | 2.7098 |
| CLogS | -5.798 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 299.81 |
| Relative PSA | 0.32164 |
| PolarSurfaceArea | 114.97 |
| Druglikeness | -2.6623 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-2-(2-bromo-4-nitrophenoxy)acetamide | 2 - N-[(Z)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-2-(2-bromo-4-nitrophenoxy)acetamide