| MolName | 5-nitro-N-[(Z)-(3-nitrophenyl)methylideneamino]-3-phenyl-1H-indole-2-carboxamide |
| MolecularFormula | C22H15N5O5 |
| Smiles | [O-][N+](c(cc1)cc2c1[nH]c(C(N/N=C\c1cccc([N+]([O-])=O)c1)=O)c2-c1ccccc1)=O |
| InChI | InChI=1S/C22H15N5O5/c28-22(25-23-13-14-5-4-8-16(11-14)26(29)30)21-20(15-6-2-1-3-7-15)18-12-17(27(31)32)9-10-19(18)24-21/h1-13,24H,(H,25,28) |
| InChIK | VOEODXIAWOVUBB-UHFFFAOYSA-N |
| TotalMolweight | 429.391 |
| Molweight | 429.391 |
| MonoisotopicMass | 429.10732 |
| CLogP | 3.111 |
| CLogS | -7.276 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 318.26 |
| Relative PSA | 0.34827 |
| PolarSurfaceArea | 148.89 |
| Druglikeness | 0.48161 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-nitro-N-[(Z)-(3-nitrophenyl)methylideneamino]-3-phenyl-1H-indole-2-carboxamide | 2 - 5-nitro-N-[(Z)-(3-nitrophenyl)methylideneamino]-3-phenyl-1H-indole-2-carboxamide