| MolName | (Z)-1-(2,4-dichlorophenyl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]methanimine |
| MolecularFormula | C14H8N2Cl4 |
| Smiles | Clc1cc(Cl)c(/C=N\N=C/c(ccc(Cl)c2)c2Cl)cc1 |
| InChI | InChI=1S/C14H8Cl4N2/c15-11-3-1-9(13(17)5-11)7-19-20-8-10-2-4-12(16)6-14(10)18/h1-8H |
| InChIK | VOXSRYYLVMOEEL-UHFFFAOYSA-N |
| TotalMolweight | 346.044 |
| Molweight | 346.044 |
| MonoisotopicMass | 343.944156 |
| CLogP | 7.2096 |
| CLogS | -7.076 |
| H Acceptors | 2 |
| TotalSurfaceArea | 244.22 |
| Relative PSA | 0.094259 |
| PolarSurfaceArea | 24.72 |
| Druglikeness | 1.7525 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(2,4-dichlorophenyl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]methanimine | 2 - (Z)-1-(2,4-dichlorophenyl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]methanimine