| MolName | [6-oxo-6-[(2Z)-2-[(4-oxochromen-3-yl)methylidene]hydrazinyl]hexyl]azanium |
| MolecularFormula | C16H20N3O3 |
| Smiles | [NH3+]CCCCCC(N/N=C\C1=COc(cccc2)c2C1=O)=O |
| InChI | InChI=1S/C16H19N3O3/c17-9-5-1-2-8-15(20)19-18-10-12-11-22-14-7-4-3-6-13(14)16(12)21/h3-4,6-7,10-11H,1-2,5,8-9,17H2,(H,19,20)/p+1 |
| InChIK | VOYDTAYYIPWMPR-UHFFFAOYSA-O |
| TotalMolweight | 302.353 |
| Molweight | 302.353 |
| MonoisotopicMass | 302.150467 |
| CLogP | -1.8025 |
| CLogS | -3.75 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 242.72 |
| Relative PSA | 0.30294 |
| PolarSurfaceArea | 95.4 |
| Druglikeness | -4.9438 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | twice activated DB; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 7 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [6-oxo-6-[(2Z)-2-[(4-oxochromen-3-yl)methylidene]hydrazinyl]hexyl]azanium | 2 - [6-oxo-6-[(2Z)-2-[(4-oxochromen-3-yl)methylidene]hydrazinyl]hexyl]azanium