| MolName | N-[(Z)-benzylideneamino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| MolecularFormula | C25H22N4O2S2 |
| Smiles | O=C(CSC(N1c2ccccc2)=Nc(sc2c3CCCC2)c3C1=O)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C25H22N4O2S2/c30-21(28-26-15-17-9-3-1-4-10-17)16-32-25-27-23-22(19-13-7-8-14-20(19)33-23)24(31)29(25)18-11-5-2-6-12-18/h1-6,9-12,15H,7-8,13-14,16H2,(H,28,30) |
| InChIK | VPBNFMIIPNYMIK-UHFFFAOYSA-N |
| TotalMolweight | 474.608 |
| Molweight | 474.608 |
| MonoisotopicMass | 474.118416 |
| CLogP | 5.4235 |
| CLogS | -7.377 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 353 |
| Relative PSA | 0.28884 |
| PolarSurfaceArea | 127.67 |
| Druglikeness | 2.463 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-benzylideneamino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide | 2 - N-[(Z)-benzylideneamino]-2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide