| MolName | N-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]-2,5-dimethylfuran-3-carboxamide |
| MolecularFormula | C25H22N4O4 |
| Smiles | Cc1cc(C(N/N=C\c2cn(-c3ccccc3)nc2-c(cc2)cc3c2OCCO3)=O)c(C)o1 |
| InChI | InChI=1S/C25H22N4O4/c1-16-12-21(17(2)33-16)25(30)27-26-14-19-15-29(20-6-4-3-5-7-20)28-24(19)18-8-9-22-23(13-18)32-11-10-31-22/h3-9,12-15H,10-11H2,1-2H3,(H,27,30) |
| InChIK | VPIDYYCNZWCJIT-UHFFFAOYSA-N |
| TotalMolweight | 442.474 |
| Molweight | 442.474 |
| MonoisotopicMass | 442.164106 |
| CLogP | 4.0299 |
| CLogS | -5.81 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 342.7 |
| Relative PSA | 0.25667 |
| PolarSurfaceArea | 90.88 |
| Druglikeness | -3.0683 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]-2,5-dimethylfuran-3-carboxamide | 2 - N-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]-2,5-dimethylfuran-3-carboxamide