| MolName | 2-hydroxy-2,2-diphenyl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide |
| MolecularFormula | C23H20N2O2 |
| Smiles | OC(C(N/N=C\C=C\c1ccccc1)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O2/c26-22(25-24-18-10-13-19-11-4-1-5-12-19)23(27,20-14-6-2-7-15-20)21-16-8-3-9-17-21/h1-18,27H,(H,25,26) |
| InChIK | VPINZUCWRRSDEY-UHFFFAOYSA-N |
| TotalMolweight | 356.424 |
| Molweight | 356.424 |
| MonoisotopicMass | 356.152478 |
| CLogP | 3.5002 |
| CLogS | -4.719 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 290.01 |
| Relative PSA | 0.16934 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 5.4777 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-2,2-diphenyl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide | 2 - 2-hydroxy-2,2-diphenyl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide