| MolName | [4-bromo-2-[(Z)-(phenylcarbamothioylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C21H15N3O2BrClS |
| Smiles | O=C(c(cc1)ccc1Cl)Oc(cc1)c(/C=N\NC(Nc2ccccc2)=S)cc1Br |
| InChI | InChI=1S/C21H15BrClN3O2S/c22-16-8-11-19(28-20(27)14-6-9-17(23)10-7-14)15(12-16)13-24-26-21(29)25-18-4-2-1-3-5-18/h1-13H,(H2,25,26,29) |
| InChIK | VPOXEFLVECTCDS-UHFFFAOYSA-N |
| TotalMolweight | 488.792 |
| Molweight | 488.792 |
| MonoisotopicMass | 486.975685 |
| CLogP | 6.3539 |
| CLogS | -7.361 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 334.97 |
| Relative PSA | 0.25516 |
| PolarSurfaceArea | 94.81 |
| Druglikeness | 0.29473 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-(phenylcarbamothioylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate | 2 - [4-bromo-2-[(Z)-(phenylcarbamothioylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate