| MolName | 6-N-benzyl-2-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C24H20N7O2Br |
| Smiles | Brc1c(/C=N\Nc2nc(Nc3ccccc3)nc(NCc3ccccc3)n2)cc2OCOc2c1 |
| InChI | InChI=1S/C24H20BrN7O2/c25-19-12-21-20(33-15-34-21)11-17(19)14-27-32-24-30-22(26-13-16-7-3-1-4-8-16)29-23(31-24)28-18-9-5-2-6-10-18/h1-12,14H,13,15H2,(H3,26,28,29,30,31,32) |
| InChIK | VPXZEZWQCXIPLZ-UHFFFAOYSA-N |
| TotalMolweight | 518.374 |
| Molweight | 518.374 |
| MonoisotopicMass | 517.086184 |
| CLogP | 7.6946 |
| CLogS | -7.841 |
| H Acceptors | 9 |
| H Donors | 3 |
| TotalSurfaceArea | 360.61 |
| Relative PSA | 0.27398 |
| PolarSurfaceArea | 105.58 |
| Druglikeness | 0.72826 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 6-N-benzyl-2-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine | 2 - 6-N-benzyl-2-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine