| MolName | N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| MolecularFormula | C18H24N8O3 |
| Smiles | [O-][N+](c1ccc(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)o1)=O |
| InChI | InChI=1S/C18H24N8O3/c27-26(28)15-8-7-14(29-15)13-19-23-16-20-17(24-9-3-1-4-10-24)22-18(21-16)25-11-5-2-6-12-25/h7-8,13H,1-6,9-12H2,(H,20,21,22,23) |
| InChIK | VQYZZPLRCWHTKJ-UHFFFAOYSA-N |
| TotalMolweight | 400.442 |
| Molweight | 400.442 |
| MonoisotopicMass | 400.197137 |
| CLogP | 4.0358 |
| CLogS | -5.986 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 310.08 |
| Relative PSA | 0.34672 |
| PolarSurfaceArea | 128.5 |
| Druglikeness | 0.68886 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 11 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine | 2 - N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine