| MolName | N-[(Z)-benzylideneamino]-N-phenylaniline |
| MolecularFormula | C19H16N2 |
| Smiles | C(c1ccccc1)=N\N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16N2/c1-4-10-17(11-5-1)16-20-21(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16H |
| InChIK | VREONUZGDYDJLN-UHFFFAOYSA-N |
| TotalMolweight | 272.35 |
| Molweight | 272.35 |
| MonoisotopicMass | 272.131348 |
| CLogP | 5.2288 |
| CLogS | -5.726 |
| H Acceptors | 2 |
| TotalSurfaceArea | 227.84 |
| Relative PSA | 0.066099 |
| PolarSurfaceArea | 15.6 |
| Druglikeness | 3.4029 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52381 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 2 |
| Electronegative Atoms | 2 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-benzylideneamino]-N-phenylaniline | 2 - N-[(Z)-benzylideneamino]-N-phenylaniline