| MolName | 5-(1-adamantyl)-N-[(Z)-(3-nitrophenyl)methylideneamino]-1H-pyrazole-3-carboxamide |
| MolecularFormula | C21H23N5O3 |
| Smiles | [O-][N+](c1cc(/C=N\NC(c2n[nH]c(C3(CC(C4)C5)CC5CC4C3)c2)=O)ccc1)=O |
| InChI | InChI=1S/C21H23N5O3/c27-20(25-22-12-13-2-1-3-17(7-13)26(28)29)18-8-19(24-23-18)21-9-14-4-15(10-21)6-16(5-14)11-21/h1-3,7-8,12,14-16H,4-6,9-11H2,(H,23,24)(H,25,27) |
| InChIK | VRYKJEQLXMNJBD-UHFFFAOYSA-N |
| TotalMolweight | 393.446 |
| Molweight | 393.446 |
| MonoisotopicMass | 393.18009 |
| CLogP | 2.4119 |
| CLogS | -5.51 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 288.96 |
| Relative PSA | 0.31627 |
| PolarSurfaceArea | 115.96 |
| Druglikeness | 1.0621 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 6 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 11 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-(1-adamantyl)-N-[(Z)-(3-nitrophenyl)methylideneamino]-1H-pyrazole-3-carboxamide | 2 - 5-(1-adamantyl)-N-[(Z)-(3-nitrophenyl)methylideneamino]-1H-pyrazole-3-carboxamide