| MolName | 5-[[(E)-3-(4-nitrophenyl)prop-2-enylidene]amino]-6-phenylpyrimidine-2,4-diamine |
| MolecularFormula | C19H16N6O2 |
| Smiles | Nc(nc(N)nc1-c2ccccc2)c1/N=C/C=C/c(cc1)ccc1[N+]([O-])=O |
| InChI | InChI=1S/C19H16N6O2/c20-18-17(16(23-19(21)24-18)14-6-2-1-3-7-14)22-12-4-5-13-8-10-15(11-9-13)25(26)27/h1-12H,(H4,20,21,23,24) |
| InChIK | VSLWSTSTUSVHGC-UHFFFAOYSA-N |
| TotalMolweight | 360.376 |
| Molweight | 360.376 |
| MonoisotopicMass | 360.133474 |
| CLogP | 1.3426 |
| CLogS | -5.632 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 282.27 |
| Relative PSA | 0.33447 |
| PolarSurfaceArea | 136 |
| Druglikeness | -5.4147 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.59259 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[[(E)-3-(4-nitrophenyl)prop-2-enylidene]amino]-6-phenylpyrimidine-2,4-diamine | 2 - 5-[[(E)-3-(4-nitrophenyl)prop-2-enylidene]amino]-6-phenylpyrimidine-2,4-diamine