| MolName | 6-tert-butyl-8-[(Z)-thiophen-2-ylmethylideneamino]-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one |
| MolecularFormula | C13H14N6OS |
| Smiles | CC(C)(C)C(C(N1/N=C\c2cccs2)=O)=Nn2c1nnc2 |
| InChI | InChI=1S/C13H14N6OS/c1-13(2,3)10-11(20)19(12-16-14-8-18(12)17-10)15-7-9-5-4-6-21-9/h4-8H,1-3H3 |
| InChIK | VSTOGFWVJBMJNI-UHFFFAOYSA-N |
| TotalMolweight | 302.361 |
| Molweight | 302.361 |
| MonoisotopicMass | 302.094979 |
| CLogP | 2.5766 |
| CLogS | -5.355 |
| H Acceptors | 7 |
| TotalSurfaceArea | 225.15 |
| Relative PSA | 0.39431 |
| PolarSurfaceArea | 103.98 |
| Druglikeness | 1.3976 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.47619 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 6-tert-butyl-8-[(Z)-thiophen-2-ylmethylideneamino]-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one | 2 - 6-tert-butyl-8-[(Z)-thiophen-2-ylmethylideneamino]-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one