| MolName | N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2,3,4,5,6-pentafluoroaniline |
| MolecularFormula | C22H12N3Cl2F5 |
| Smiles | Fc(c(N/N=C\c1cn(Cc(ccc(Cl)c2)c2Cl)c2c1cccc2)c(c(F)c1F)F)c1F |
| InChI | InChI=1S/C22H12Cl2F5N3/c23-13-6-5-11(15(24)7-13)9-32-10-12(14-3-1-2-4-16(14)32)8-30-31-22-20(28)18(26)17(25)19(27)21(22)29/h1-8,10,31H,9H2 |
| InChIK | VTVYISXKFRYMPG-UHFFFAOYSA-N |
| TotalMolweight | 484.254 |
| Molweight | 484.254 |
| MonoisotopicMass | 483.032841 |
| CLogP | 8.0866 |
| CLogS | -7.169 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 329.15 |
| Relative PSA | 0.090658 |
| PolarSurfaceArea | 29.32 |
| Druglikeness | 3.0439 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2,3,4,5,6-pentafluoroaniline | 2 - N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2,3,4,5,6-pentafluoroaniline