| MolName | 2-(2-bromo-4-chlorophenoxy)-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide |
| MolecularFormula | C13H9N3O4BrClS |
| Smiles | [O-][N+](c1ccc(/C=N\NC(COc(ccc(Cl)c2)c2Br)=O)s1)=O |
| InChI | InChI=1S/C13H9BrClN3O4S/c14-10-5-8(15)1-3-11(10)22-7-12(19)17-16-6-9-2-4-13(23-9)18(20)21/h1-6H,7H2,(H,17,19) |
| InChIK | VUBZUUSHDFIBJF-UHFFFAOYSA-N |
| TotalMolweight | 418.654 |
| Molweight | 418.654 |
| MonoisotopicMass | 416.918565 |
| CLogP | 3.2423 |
| CLogS | -5.691 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 264.41 |
| Relative PSA | 0.36606 |
| PolarSurfaceArea | 124.75 |
| Druglikeness | -1.3755 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-bromo-4-chlorophenoxy)-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide | 2 - 2-(2-bromo-4-chlorophenoxy)-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide