| MolName | (1R,2R,6S,7S)-4-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione |
| MolecularFormula | C22H17N3O5 |
| Smiles | [O-][N+](c(cc1)ccc1-c1ccc(/C=N\N(C([C@H]([C@H]23)[C@@H]4C=C[C@H]3C43CC3)=O)C2=O)o1)=O |
| InChI | InChI=1S/C22H17N3O5/c26-20-18-15-6-7-16(22(15)9-10-22)19(18)21(27)24(20)23-11-14-5-8-17(30-14)12-1-3-13(4-2-12)25(28)29/h1-8,11,15-16,18-19H,9-10H2/t15-,16-,18-,19+/m1/s1 |
| InChIK | VUCKIMOXUOPIOH-RWQQGDIJSA-N |
| TotalMolweight | 403.393 |
| Molweight | 403.393 |
| MonoisotopicMass | 403.116822 |
| CLogP | 2.0634 |
| CLogS | -5.611 |
| H Acceptors | 8 |
| TotalSurfaceArea | 277.37 |
| Relative PSA | 0.30887 |
| PolarSurfaceArea | 108.7 |
| Druglikeness | 2.2849 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| StereoCenters | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 6 |
| Small Rings | 7 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 8 |
| Symmetricatoms | 3 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (1R,2R,6S,7S)-4-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione | 2 - (1R,2R,6S,7S)-4-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione