| MolName | N'-[(E)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-(2-phenylethyl)propanediamide |
| MolecularFormula | C20H22N4O4 |
| Smiles | NC(COc1ccc(/C=N/NC(CC(NCCc2ccccc2)=O)=O)cc1)=O |
| InChI | InChI=1S/C20H22N4O4/c21-18(25)14-28-17-8-6-16(7-9-17)13-23-24-20(27)12-19(26)22-11-10-15-4-2-1-3-5-15/h1-9,13H,10-12,14H2,(H2,21,25)(H,22,26)(H,24,27) |
| InChIK | VUFZCJPJUSJCOT-UHFFFAOYSA-N |
| TotalMolweight | 382.419 |
| Molweight | 382.419 |
| MonoisotopicMass | 382.164106 |
| CLogP | 1.4 |
| CLogS | -3.592 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 307.51 |
| Relative PSA | 0.32136 |
| PolarSurfaceArea | 122.88 |
| Druglikeness | 2.7705 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 10 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(E)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-(2-phenylethyl)propanediamide | 2 - N'-[(E)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-N-(2-phenylethyl)propanediamide