| MolName | N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]pyridin-2-amine |
| MolecularFormula | C19H17N3O |
| Smiles | C(c1ccccc1)Oc1cc(/C=N\Nc2ncccc2)ccc1 |
| InChI | InChI=1S/C19H17N3O/c1-2-7-16(8-3-1)15-23-18-10-6-9-17(13-18)14-21-22-19-11-4-5-12-20-19/h1-14H,15H2,(H,20,22) |
| InChIK | VUPGHKZTIDMPNR-UHFFFAOYSA-N |
| TotalMolweight | 303.364 |
| Molweight | 303.364 |
| MonoisotopicMass | 303.137162 |
| CLogP | 5.5395 |
| CLogS | -4.22 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 251.52 |
| Relative PSA | 0.1747 |
| PolarSurfaceArea | 46.51 |
| Druglikeness | 1.6288 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]pyridin-2-amine | 2 - N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]pyridin-2-amine