| MolName | 3-[(Z)-(benzhydrylidenehydrazinylidene)methyl]phenol |
| MolecularFormula | C20H16N2O |
| Smiles | Oc1cc(/C=N\N=C(c2ccccc2)c2ccccc2)ccc1 |
| InChI | InChI=1S/C20H16N2O/c23-19-13-7-8-16(14-19)15-21-22-20(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-15,23H |
| InChIK | VUSWALHBKFQEFI-UHFFFAOYSA-N |
| TotalMolweight | 300.36 |
| Molweight | 300.36 |
| MonoisotopicMass | 300.126263 |
| CLogP | 5.6366 |
| CLogS | -5.612 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 246.86 |
| Relative PSA | 0.14632 |
| PolarSurfaceArea | 44.95 |
| Druglikeness | 1.7314 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.52174 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(benzhydrylidenehydrazinylidene)methyl]phenol | 2 - 3-[(Z)-(benzhydrylidenehydrazinylidene)methyl]phenol