| MolName | 2-[4-[(Z)-[(4-amino-1,2,5-oxadiazole-3-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C12H11N5O5 |
| Smiles | Nc1nonc1C(N/N=C\c(cc1)ccc1OCC(O)=O)=O |
| InChI | InChI=1S/C12H11N5O5/c13-11-10(16-22-17-11)12(20)15-14-5-7-1-3-8(4-2-7)21-6-9(18)19/h1-5H,6H2,(H2,13,17)(H,15,20)(H,18,19) |
| InChIK | VUTGJYSKZSXEAZ-UHFFFAOYSA-N |
| TotalMolweight | 305.249 |
| Molweight | 305.249 |
| MonoisotopicMass | 305.07602 |
| CLogP | 0.501 |
| CLogS | -2.382 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 230.58 |
| Relative PSA | 0.53548 |
| PolarSurfaceArea | 152.93 |
| Druglikeness | 6.1487 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-[(4-amino-1,2,5-oxadiazole-3-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[4-[(Z)-[(4-amino-1,2,5-oxadiazole-3-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid