| MolName | [(Z)-dibenzofuran-2-ylmethylideneamino]urea |
| MolecularFormula | C14H11N3O2 |
| Smiles | NC(N/N=C\c(cc1)cc2c1oc1c2cccc1)=O |
| InChI | InChI=1S/C14H11N3O2/c15-14(18)17-16-8-9-5-6-13-11(7-9)10-3-1-2-4-12(10)19-13/h1-8H,(H3,15,17,18) |
| InChIK | VUUIHFWBLSMELY-UHFFFAOYSA-N |
| TotalMolweight | 253.26 |
| Molweight | 253.26 |
| MonoisotopicMass | 253.085127 |
| CLogP | 2.9038 |
| CLogS | -5.474 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 194.64 |
| Relative PSA | 0.33595 |
| PolarSurfaceArea | 80.62 |
| Druglikeness | 4.1684 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 2 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 13 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-dibenzofuran-2-ylmethylideneamino]urea | 2 - [(Z)-dibenzofuran-2-ylmethylideneamino]urea