| MolName | 3-phenyl-4-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-1,2,4-triazol-5-one |
| MolecularFormula | C17H14N4O |
| Smiles | O=C(NN=C1c2ccccc2)N1/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C17H14N4O/c22-17-20-19-16(15-11-5-2-6-12-15)21(17)18-13-7-10-14-8-3-1-4-9-14/h1-13H,(H,20,22) |
| InChIK | VUVIYOICCIVIJZ-UHFFFAOYSA-N |
| TotalMolweight | 290.325 |
| Molweight | 290.325 |
| MonoisotopicMass | 290.116761 |
| CLogP | 2.9528 |
| CLogS | -4.659 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 233.26 |
| Relative PSA | 0.21894 |
| PolarSurfaceArea | 57.06 |
| Druglikeness | 4.6001 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 3-phenyl-4-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-1,2,4-triazol-5-one | 2 - 3-phenyl-4-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-1,2,4-triazol-5-one