| MolName | 3-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| MolecularFormula | C15H12N4O3S2 |
| Smiles | [O-][N+](c1ccc(/C=N\N(C=Nc2c3c(CCCC4)c4s2)C3=O)s1)=O |
| InChI | InChI=1S/C15H12N4O3S2/c20-15-13-10-3-1-2-4-11(10)24-14(13)16-8-18(15)17-7-9-5-6-12(23-9)19(21)22/h5-8H,1-4H2 |
| InChIK | VVHOYYXCVRNGKR-UHFFFAOYSA-N |
| TotalMolweight | 360.417 |
| Molweight | 360.417 |
| MonoisotopicMass | 360.035081 |
| CLogP | 2.8196 |
| CLogS | -5.671 |
| H Acceptors | 7 |
| TotalSurfaceArea | 254.18 |
| Relative PSA | 0.43571 |
| PolarSurfaceArea | 147.33 |
| Druglikeness | -3.5738 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one