| MolName | 3-[(Z)-(4-pyrrolidin-1-ylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| MolecularFormula | C21H22N4OS |
| Smiles | O=C(c1c(N=C2)sc3c1CCCC3)N2/N=C\c(cc1)ccc1N1CCCC1 |
| InChI | InChI=1S/C21H22N4OS/c26-21-19-17-5-1-2-6-18(17)27-20(19)22-14-25(21)23-13-15-7-9-16(10-8-15)24-11-3-4-12-24/h7-10,13-14H,1-6,11-12H2 |
| InChIK | VWGYFOCIHVETGZ-UHFFFAOYSA-N |
| TotalMolweight | 378.499 |
| Molweight | 378.499 |
| MonoisotopicMass | 378.151431 |
| CLogP | 4.176 |
| CLogS | -5.773 |
| H Acceptors | 5 |
| TotalSurfaceArea | 286.41 |
| Relative PSA | 0.22178 |
| PolarSurfaceArea | 76.51 |
| Druglikeness | 3.3737 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59259 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(4-pyrrolidin-1-ylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-(4-pyrrolidin-1-ylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one