| MolName | 2-(2,5-dichlorophenoxy)-N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]acetamide |
| MolecularFormula | C15H12N2O3Cl2 |
| Smiles | O=C(COc(cc(cc1)Cl)c1Cl)N/N=C\C=C\c1ccco1 |
| InChI | InChI=1S/C15H12Cl2N2O3/c16-11-5-6-13(17)14(9-11)22-10-15(20)19-18-7-1-3-12-4-2-8-21-12/h1-9H,10H2,(H,19,20) |
| InChIK | VWSPFHCLNLWRPQ-UHFFFAOYSA-N |
| TotalMolweight | 339.177 |
| Molweight | 339.177 |
| MonoisotopicMass | 338.022497 |
| CLogP | 3.1955 |
| CLogS | -4.947 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 257.78 |
| Relative PSA | 0.23322 |
| PolarSurfaceArea | 63.83 |
| Druglikeness | 4.2385 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2,5-dichlorophenoxy)-N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]acetamide | 2 - 2-(2,5-dichlorophenoxy)-N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]acetamide