| MolName | 4-[[4-hydroxy-3-[[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]phenyl]methyl]-2-[[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]phenol |
| MolecularFormula | C31H24N4O6 |
| Smiles | [O-][N+](c1c(/C=C/C=N/c(cc(Cc(cc2)cc(/N=C/C=C/c(cccc3)c3[N+]([O-])=O)c2O)cc2)c2O)cccc1)=O |
| InChI | InChI=1S/C31H24N4O6/c36-30-15-13-22(20-26(30)32-17-5-9-24-7-1-3-11-28(24)34(38)39)19-23-14-16-31(37)27(21-23)33-18-6-10-25-8-2-4-12-29(25)35(40)41/h1-18,20-21,36-37H,19H2 |
| InChIK | VXNJTOKWPWBPNJ-UHFFFAOYSA-N |
| TotalMolweight | 548.554 |
| Molweight | 548.554 |
| MonoisotopicMass | 548.169586 |
| CLogP | 3.7251 |
| CLogS | -7.323 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 428.86 |
| Relative PSA | 0.25663 |
| PolarSurfaceArea | 156.82 |
| Druglikeness | -5.4535 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.56098 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 5 |
| Symmetricatoms | 20 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[[4-hydroxy-3-[[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]phenyl]methyl]-2-[[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]phenol | 2 - 4-[[4-hydroxy-3-[[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]phenyl]methyl]-2-[[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]phenol