| MolName | 4-amino-3-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C7H8N6S2 |
| Smiles | NN(C(N/N=C\c1cccs1)=NN1)C1=S |
| InChI | InChI=1S/C7H8N6S2/c8-13-6(11-12-7(13)14)10-9-4-5-2-1-3-15-5/h1-4H,8H2,(H,10,11)(H,12,14) |
| InChIK | VXPKITKTEJYPNZ-UHFFFAOYSA-N |
| TotalMolweight | 240.315 |
| Molweight | 240.315 |
| MonoisotopicMass | 240.025184 |
| CLogP | 0.3261 |
| CLogS | -3.831 |
| H Acceptors | 6 |
| H Donors | 3 |
| TotalSurfaceArea | 177.88 |
| Relative PSA | 0.63593 |
| PolarSurfaceArea | 138.37 |
| Druglikeness | 3.1692 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 15 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-3-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]-1H-1,2,4-triazole-5-thione | 2 - 4-amino-3-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]-1H-1,2,4-triazole-5-thione