[4-[(Z)-[[2-(4-bromoanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate
Formula:C22H15N3O4Br2
Mutagenic:none
Tumorigenic:high
Reproductive Effective:none
[4-[(Z)-[[2-(4-bromoanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate is not a drug-like molecule.
| MolName | [4-[(Z)-[[2-(4-bromoanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate |
| MolecularFormula | C22H15N3O4Br2 |
| Smiles | O=C(C(N/N=C\c(cc1)ccc1OC(c(cccc1)c1Br)=O)=O)Nc(cc1)ccc1Br |
| InChI | InChI=1S/C22H15Br2N3O4/c23-15-7-9-16(10-8-15)26-20(28)21(29)27-25-13-14-5-11-17(12-6-14)31-22(30)18-3-1-2-4-19(18)24/h1-13H,(H,26,28)(H,27,29) |
| InChIK | VXUCVUMUQFNGJU-UHFFFAOYSA-N |
| TotalMolweight | 545.186 |
| Molweight | 545.186 |
| MonoisotopicMass | 542.942929 |
| CLogP | 5.0248 |
| CLogS | -6.663 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 340.97 |
| Relative PSA | 0.24504 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 1.585 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.67742 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-(4-bromoanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate | 2 - [4-[(Z)-[[2-(4-bromoanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate
Spacefill |
Wire |
Ball & Stick |
Iso-vdw |
Opaque |
Dot Surface |
Mep |
Translucent |
Spin |
Label On |
Off