| MolName | 4-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]-3-(phenoxymethyl)-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C16H14N4O2S |
| Smiles | S=C(NN=C1COc2ccccc2)N1/N=C\C=C\c1ccco1 |
| InChI | InChI=1S/C16H14N4O2S/c23-16-19-18-15(12-22-14-6-2-1-3-7-14)20(16)17-10-4-8-13-9-5-11-21-13/h1-11H,12H2,(H,19,23) |
| InChIK | VXVVMRDWWQCBQD-UHFFFAOYSA-N |
| TotalMolweight | 326.379 |
| Molweight | 326.379 |
| MonoisotopicMass | 326.083746 |
| CLogP | 2.1022 |
| CLogS | -4.205 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 261.67 |
| Relative PSA | 0.34448 |
| PolarSurfaceArea | 94.45 |
| Druglikeness | 3.3368 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]-3-(phenoxymethyl)-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]-3-(phenoxymethyl)-1H-1,2,4-triazole-5-thione