| MolName | N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide |
| MolecularFormula | C21H18N4O |
| Smiles | O=C(c1c(CCc2c-3cccc2)c3n[nH]1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C21H18N4O/c26-21(25-22-14-6-9-15-7-2-1-3-8-15)20-18-13-12-16-10-4-5-11-17(16)19(18)23-24-20/h1-11,14H,12-13H2,(H,23,24)(H,25,26) |
| InChIK | VYBSJYNVNDDSFF-UHFFFAOYSA-N |
| TotalMolweight | 342.401 |
| Molweight | 342.401 |
| MonoisotopicMass | 342.148061 |
| CLogP | 3.3905 |
| CLogS | -4.94 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 275.6 |
| Relative PSA | 0.22123 |
| PolarSurfaceArea | 70.14 |
| Druglikeness | 4.7404 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide | 2 - N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide