| MolName | N-[2-[(2Z)-2-[(2,4-dioxo-1H-pyrimidin-6-yl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide |
| MolecularFormula | C21H19N5O4 |
| Smiles | O=C(CNC(C(c1ccccc1)c1ccccc1)=O)N/N=C\C(NC(N1)=O)=CC1=O |
| InChI | InChI=1S/C21H19N5O4/c27-17-11-16(24-21(30)25-17)12-23-26-18(28)13-22-20(29)19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-12,19H,13H2,(H,22,29)(H,26,28)(H2,24,25,27,30) |
| InChIK | VYLFSSXIVTWOPJ-UHFFFAOYSA-N |
| TotalMolweight | 405.413 |
| Molweight | 405.413 |
| MonoisotopicMass | 405.143705 |
| CLogP | 0.707 |
| CLogS | -3.878 |
| H Acceptors | 9 |
| H Donors | 4 |
| TotalSurfaceArea | 312.09 |
| Relative PSA | 0.35089 |
| PolarSurfaceArea | 128.76 |
| Druglikeness | 5.6137 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| Amides | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-[(2,4-dioxo-1H-pyrimidin-6-yl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide | 2 - N-[2-[(2Z)-2-[(2,4-dioxo-1H-pyrimidin-6-yl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide