| MolName | N-[(Z)-(4-chlorophenyl)methylideneamino]-3-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]benzamide |
| MolecularFormula | C21H16N4OCl2 |
| Smiles | O=C(c1cccc(N/N=C\c(cc2)ccc2Cl)c1)N/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C21H16Cl2N4O/c22-18-8-4-15(5-9-18)13-24-26-20-3-1-2-17(12-20)21(28)27-25-14-16-6-10-19(23)11-7-16/h1-14,26H,(H,27,28) |
| InChIK | VYMIGQNQQXUITC-UHFFFAOYSA-N |
| TotalMolweight | 411.291 |
| Molweight | 411.291 |
| MonoisotopicMass | 410.070115 |
| CLogP | 7.5949 |
| CLogS | -6.726 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 313.81 |
| Relative PSA | 0.18795 |
| PolarSurfaceArea | 65.85 |
| Druglikeness | 4.4715 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-chlorophenyl)methylideneamino]-3-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]benzamide | 2 - N-[(Z)-(4-chlorophenyl)methylideneamino]-3-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]benzamide