| MolName | (E)-3-phenyl-N-[4-[2-[4-[[(E)-3-phenylprop-2-enylidene]amino]phenyl]ethyl]phenyl]prop-2-en-1-imine |
| MolecularFormula | C32H28N2 |
| Smiles | C(Cc(cc1)ccc1/N=C/C=C/c1ccccc1)c(cc1)ccc1/N=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C32H28N2/c1-3-9-27(10-4-1)13-7-25-33-31-21-17-29(18-22-31)15-16-30-19-23-32(24-20-30)34-26-8-14-28-11-5-2-6-12-28/h1-14,17-26H,15-16H2 |
| InChIK | VYZDRRDDEMEWKP-UHFFFAOYSA-N |
| TotalMolweight | 440.588 |
| Molweight | 440.588 |
| MonoisotopicMass | 440.225248 |
| CLogP | 6.6452 |
| CLogS | -6.922 |
| H Acceptors | 2 |
| TotalSurfaceArea | 382.58 |
| Relative PSA | 0.06017 |
| PolarSurfaceArea | 24.72 |
| Druglikeness | -1.3312 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.76471 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 2 |
| Electronegative Atoms | 2 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 2 |
| Symmetricatoms | 21 |
| StereoCon |
Click to Load Molecule:
1 - (E)-3-phenyl-N-[4-[2-[4-[[(E)-3-phenylprop-2-enylidene]amino]phenyl]ethyl]phenyl]prop-2-en-1-imine | 2 - (E)-3-phenyl-N-[4-[2-[4-[[(E)-3-phenylprop-2-enylidene]amino]phenyl]ethyl]phenyl]prop-2-en-1-imine