| MolName | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(5-chloro-2-nitrophenyl)methylideneamino]acetamide |
| MolecularFormula | C16H11N4O3ClS2 |
| Smiles | [O-][N+](c(cc1)c(/C=N\NC(CSc2nc(cccc3)c3s2)=O)cc1Cl)=O |
| InChI | InChI=1S/C16H11ClN4O3S2/c17-11-5-6-13(21(23)24)10(7-11)8-18-20-15(22)9-25-16-19-12-3-1-2-4-14(12)26-16/h1-8H,9H2,(H,20,22) |
| InChIK | VZCFYSMPNLKYLE-UHFFFAOYSA-N |
| TotalMolweight | 406.873 |
| Molweight | 406.873 |
| MonoisotopicMass | 405.996108 |
| CLogP | 3.6007 |
| CLogS | -6.295 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 286.63 |
| Relative PSA | 0.40209 |
| PolarSurfaceArea | 153.71 |
| Druglikeness | -0.32474 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(5-chloro-2-nitrophenyl)methylideneamino]acetamide | 2 - 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(5-chloro-2-nitrophenyl)methylideneamino]acetamide