| MolName | N-[5-[2-[(2E)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide |
| MolecularFormula | C18H14N5O2ClS |
| Smiles | O=C(Cc1nnc(NC(c2ccccc2)=O)s1)N/N=C/c(cccc1)c1Cl |
| InChI | InChI=1S/C18H14ClN5O2S/c19-14-9-5-4-8-13(14)11-20-22-15(25)10-16-23-24-18(27-16)21-17(26)12-6-2-1-3-7-12/h1-9,11H,10H2,(H,22,25)(H,21,24,26) |
| InChIK | VZHQMHIXZYLWQW-UHFFFAOYSA-N |
| TotalMolweight | 399.861 |
| Molweight | 399.861 |
| MonoisotopicMass | 399.055672 |
| CLogP | 3.7962 |
| CLogS | -5.141 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 298.6 |
| Relative PSA | 0.34431 |
| PolarSurfaceArea | 124.58 |
| Druglikeness | 6.5147 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[5-[2-[(2E)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide | 2 - N-[5-[2-[(2E)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide